C13H20N2OS — CID 94690828
2-[1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanylethanol (PubChem CID 94690828) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanylethanol.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanylethanol |
|---|---|
| PubChem CID | 94690828 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanylethanol |
| SMILES | OCCSc1nccn1CCC1=CCCCC1 |
| InChI | InChI=1S/C13H20N2OS/c16-10-11-17-13-14-7-9-15(13)8-6-12-4-2-1-3-5-12/h4,7,9,16H,1-3,5-6,8,10-11H2 |
| InChIKey | MTAXPCRAEHYMIO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|