C13H19N3OS — CID 106559088
N-(3-methoxypropyl)-1-(2-thiophen-2-ylethyl)imidazol-2-amine (PubChem CID 106559088) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-(2-thiophen-2-ylethyl)imidazol-2-amine.
| Compound Name | N-(3-methoxypropyl)-1-(2-thiophen-2-ylethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106559088 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(3-methoxypropyl)-1-(2-thiophen-2-ylethyl)imidazol-2-amine |
| SMILES | COCCCNc1nccn1CCc1cccs1 |
| InChI | InChI=1S/C13H19N3OS/c1-17-10-3-6-14-13-15-7-9-16(13)8-5-12-4-2-11-18-12/h2,4,7,9,11H,3,5-6,8,10H2,1H3,(H,14,15) |
| InChIKey | ZKIIWTDOLSYNTP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|