C13H19N3S — CID 55235170
1-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]butan-2-amine (PubChem CID 55235170) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]butan-2-amine.
| Compound Name | 1-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 55235170 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-[1-(2-thiophen-2-ylethyl)imidazol-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1nccn1CCc1cccs1 |
| InChI | InChI=1S/C13H19N3S/c1-2-11(14)10-13-15-6-8-16(13)7-5-12-4-3-9-17-12/h3-4,6,8-9,11H,2,5,7,10,14H2,1H3 |
| InChIKey | FAQFUPBLKZKYIB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |