C9H15F2N3 — CID 82009899
1-[1-(2,2-difluoroethyl)imidazol-2-yl]butan-2-amine (PubChem CID 82009899) has the molecular formula C9H15F2N3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)imidazol-2-yl]butan-2-amine.
| Compound Name | 1-[1-(2,2-difluoroethyl)imidazol-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 82009899 |
| Molecular Formula | C9H15F2N3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)imidazol-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1nccn1CC(F)F |
| InChI | InChI=1S/C9H15F2N3/c1-2-7(12)5-9-13-3-4-14(9)6-8(10)11/h3-4,7-8H,2,5-6,12H2,1H3 |
| InChIKey | XXWFFEHKYUARRF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |