C20H30N4O3S+2 — CID 7126781
1-[(3R)-2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-4-piperidin-1-ium-1-ylpiperidin-1-ium-4-carboxamide (PubChem CID 7126781) has the molecular formula C20H30N4O3S+2 and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[(3R)-2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-4-piperidin-1-ium-1-ylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(3R)-2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-4-piperidin-1-ium-1-ylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7126781 |
| Molecular Formula | C20H30N4O3S+2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[(3R)-2,5-dioxo-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-4-piperidin-1-ium-1-ylpiperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1([NH+]2CCCCC2)CC[NH+]([C@@H]2CC(=O)N(Cc3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C20H28N4O3S/c21-19(27)20(23-8-2-1-3-9-23)6-10-22(11-7-20)16-13-17(25)24(18(16)26)14-15-5-4-12-28-15/h4-5,12,16H,1-3,6-11,13-14H2,(H2,21,27)/p+2/t16-/m1/s1 |
| InChIKey | ASOIDEQDJQHLPF-MRXNPFEDSA-P |
| XLogP | -1.65 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|