C20H20N2OS2 — CID 173281804
2-[bis(thiophen-2-ylmethyl)amino]-1,3-dihydroindene-2-carboxamide (PubChem CID 173281804) has the molecular formula C20H20N2OS2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-[bis(thiophen-2-ylmethyl)amino]-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-[bis(thiophen-2-ylmethyl)amino]-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 173281804 |
| Molecular Formula | C20H20N2OS2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[bis(thiophen-2-ylmethyl)amino]-1,3-dihydroindene-2-carboxamide |
| SMILES | NC(=O)C1(N(Cc2cccs2)Cc2cccs2)Cc2ccccc2C1 |
| InChI | InChI=1S/C20H20N2OS2/c21-19(23)20(11-15-5-1-2-6-16(15)12-20)22(13-17-7-3-9-24-17)14-18-8-4-10-25-18/h1-10H,11-14H2,(H2,21,23) |
| InChIKey | JJPIHBQYJCKCLR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |