C15H13NO4S — CID 82177450
2-(benzenesulfonyl)-1,3-dihydroisoindole-5-carboxylic acid (PubChem CID 82177450) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1,3-dihydroisoindole-5-carboxylic acid.
| Compound Name | 2-(benzenesulfonyl)-1,3-dihydroisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 82177450 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-(benzenesulfonyl)-1,3-dihydroisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CN(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H13NO4S/c17-15(18)11-6-7-12-9-16(10-13(12)8-11)21(19,20)14-4-2-1-3-5-14/h1-8H,9-10H2,(H,17,18) |
| InChIKey | LXAMFIXYBCESJT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |