C22H28N2O2S — CID 155566829
2-(benzenesulfonyl)-5-(1-propylpiperidin-4-yl)-1,3-dihydroisoindole (PubChem CID 155566829) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-(1-propylpiperidin-4-yl)-1,3-dihydroisoindole.
| Compound Name | 2-(benzenesulfonyl)-5-(1-propylpiperidin-4-yl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 155566829 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-(benzenesulfonyl)-5-(1-propylpiperidin-4-yl)-1,3-dihydroisoindole |
| SMILES | CCCN1CCC(c2ccc3c(c2)CN(S(=O)(=O)c2ccccc2)C3)CC1 |
| InChI | InChI=1S/C22H28N2O2S/c1-2-12-23-13-10-18(11-14-23)19-8-9-20-16-24(17-21(20)15-19)27(25,26)22-6-4-3-5-7-22/h3-9,15,18H,2,10-14,16-17H2,1H3 |
| InChIKey | HPEHGGUDPLECHX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |