C22H18Cl2N2O3S — CID 16930749
N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3,4-dichlorobenzamide (PubChem CID 16930749) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 16930749 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CN(S(=O)(=O)c1ccccc1)CC2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O3S/c23-20-9-7-16(13-21(20)24)22(27)25-18-8-6-15-10-11-26(14-17(15)12-18)30(28,29)19-4-2-1-3-5-19/h1-9,12-13H,10-11,14H2,(H,25,27) |
| InChIKey | JABFFIDHCOQKLH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |