C23H22N2O4S — CID 16930748
benzyl N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamate (PubChem CID 16930748) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is benzyl N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamate.
| Compound Name | benzyl N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamate |
|---|---|
| PubChem CID | 16930748 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | benzyl N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamate |
| SMILES | O=C(Nc1ccc2c(c1)CN(S(=O)(=O)c1ccccc1)CC2)OCc1ccccc1 |
| InChI | InChI=1S/C23H22N2O4S/c26-23(29-17-18-7-3-1-4-8-18)24-21-12-11-19-13-14-25(16-20(19)15-21)30(27,28)22-9-5-2-6-10-22/h1-12,15H,13-14,16-17H2,(H,24,26) |
| InChIKey | CPJKSPWTGMJVEK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |