C22H19BrN2O3S — CID 16930774
N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-bromobenzamide (PubChem CID 16930774) has the molecular formula C22H19BrN2O3S and a molecular weight of 471.38 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-bromobenzamide.
| Compound Name | N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 16930774 |
| Molecular Formula | C22H19BrN2O3S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-bromobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CN(S(=O)(=O)c1ccccc1)CC2)c1ccccc1Br |
| InChI | InChI=1S/C22H19BrN2O3S/c23-21-9-5-4-8-20(21)22(26)24-18-11-10-16-12-13-25(15-17(16)14-18)29(27,28)19-6-2-1-3-7-19/h1-11,14H,12-13,15H2,(H,24,26) |
| InChIKey | MSJUMNVQGNIVER-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |