C23H21N3O5S — CID 16930728
N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3-methyl-4-nitrobenzamide (PubChem CID 16930728) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 16930728 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-7-yl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)CN(S(=O)(=O)c2ccccc2)CC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21N3O5S/c1-16-13-18(8-10-22(16)26(28)29)23(27)24-20-9-7-17-11-12-25(15-19(17)14-20)32(30,31)21-5-3-2-4-6-21/h2-10,13-14H,11-12,15H2,1H3,(H,24,27) |
| InChIKey | KATVIWAKKKFCOW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|