C20H21NO6S — CID 174517667
4-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]benzene-1,3-dicarboxylic acid (PubChem CID 174517667) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174517667 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(CC2CCN(S(=O)(=O)c3ccccc3)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H21NO6S/c22-19(23)16-7-6-15(18(13-16)20(24)25)12-14-8-10-21(11-9-14)28(26,27)17-4-2-1-3-5-17/h1-7,13-14H,8-12H2,(H,22,23)(H,24,25) |
| InChIKey | KSIQOYKYWHMWDQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |