C17H14N2O7S — CID 21472181
2-[3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylphenoxy]acetic acid (PubChem CID 21472181) has the molecular formula C17H14N2O7S and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-[3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylphenoxy]acetic acid.
| Compound Name | 2-[3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylphenoxy]acetic acid |
|---|---|
| PubChem CID | 21472181 |
| Molecular Formula | C17H14N2O7S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-[3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylphenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(S(=O)(=O)N2C(=O)CN(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C17H14N2O7S/c20-15-10-18(12-5-2-1-3-6-12)17(23)19(15)27(24,25)14-8-4-7-13(9-14)26-11-16(21)22/h1-9H,10-11H2,(H,21,22) |
| InChIKey | JLKKRDWEHNCHLK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|