C22H24N4O5S — CID 21472173
3-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]sulfonyl-1-phenylimidazolidine-2,4-dione (PubChem CID 21472173) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 3-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]sulfonyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]sulfonyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21472173 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]sulfonyl-1-phenylimidazolidine-2,4-dione |
| SMILES | CN1CCN(C(=O)Cc2ccccc2S(=O)(=O)N2C(=O)CN(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C22H24N4O5S/c1-23-11-13-24(14-12-23)20(27)15-17-7-5-6-10-19(17)32(30,31)26-21(28)16-25(22(26)29)18-8-3-2-4-9-18/h2-10H,11-16H2,1H3 |
| InChIKey | WFYRGRVNZPSXGT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|