2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid

C14H13NO5 — CID 63266368

IUPAC2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid
SMILESCC1=C(C)C(=O)N(c2cccc(OCC(=O)O)c2)C1=O
InChIInChI=1S/C14H13NO5/c1-8-9(2)14(19)15(13(8)18)10-4-3-5-11(6-10)20-7-12(16)17/h3-6H,7H2,1-2H3,(H,16,17)
InChIKeyVEUDVPGDMMZUPV-UHFFFAOYSA-N
MW275.26 g/mol
LogP1.36
Rot. Bonds4

About 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid

2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid (PubChem CID 63266368) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid
PubChem CID63266368
Molecular FormulaC14H13NO5
Molecular Weight275.26 g/mol
Exact Mass275.08
IUPAC Name2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid
SMILESCC1=C(C)C(=O)N(c2cccc(OCC(=O)O)c2)C1=O
InChIInChI=1S/C14H13NO5/c1-8-9(2)14(19)15(13(8)18)10-4-3-5-11(6-10)20-7-12(16)17/h3-6H,7H2,1-2H3,(H,16,17)
InChIKeyVEUDVPGDMMZUPV-UHFFFAOYSA-N
XLogP1.36
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.26
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid?
The IUPAC name of 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid (CID 63266368) is 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid is CC1=C(C)C(=O)N(c2cccc(OCC(=O)O)c2)C1=O.
What is the InChIKey of 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid?
The InChIKey is VEUDVPGDMMZUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO5/c1-8-9(2)14(19)15(13(8)18)10-4-3-5-11(6-10)20-7-12(16)17/h3-6H,7H2,1-2H3,(H,16,17).
What are the key properties of 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid?
2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid has a molecular weight of 275.26 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]acetic acid is sourced from PubChem (CID 63266368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).