C14H15NO5 — CID 103499601
2-[3-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)phenoxy]acetic acid (PubChem CID 103499601) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[3-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)phenoxy]acetic acid.
| Compound Name | 2-[3-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 103499601 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[3-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)phenoxy]acetic acid |
| SMILES | CC1C(=O)N(c2cccc(OCC(=O)O)c2)C(=O)C1C |
| InChI | InChI=1S/C14H15NO5/c1-8-9(2)14(19)15(13(8)18)10-4-3-5-11(6-10)20-7-12(16)17/h3-6,8-9H,7H2,1-2H3,(H,16,17) |
| InChIKey | CELOGGXHURBFTG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|