C28H23NO4 — CID 4564131
2-[3-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 4564131) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[3-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[3-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4564131 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[3-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C(COc1cccc(N2C(=O)C3CC=CCC3C2=O)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23NO4/c30-26(21-15-13-20(14-16-21)19-7-2-1-3-8-19)18-33-23-10-6-9-22(17-23)29-27(31)24-11-4-5-12-25(24)28(29)32/h1-10,13-17,24-25H,11-12,18H2 |
| InChIKey | YLBIQCZQQUYSMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|