C16H9Cl3N2O3 — CID 19006415
1-(4-chlorophenyl)-3-(2,6-dichlorobenzoyl)imidazolidine-2,4-dione (PubChem CID 19006415) has the molecular formula C16H9Cl3N2O3 and a molecular weight of 383.62 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,6-dichlorobenzoyl)imidazolidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-3-(2,6-dichlorobenzoyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19006415 |
| Molecular Formula | C16H9Cl3N2O3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,6-dichlorobenzoyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccc(Cl)cc2)C(=O)N1C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H9Cl3N2O3/c17-9-4-6-10(7-5-9)20-8-13(22)21(16(20)24)15(23)14-11(18)2-1-3-12(14)19/h1-7H,8H2 |
| InChIKey | AOXSVVRBGWTUJY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|