C14H10Cl2N2O — CID 104839596
8-chloro-4-(4-chlorophenyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 104839596) has the molecular formula C14H10Cl2N2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 8-chloro-4-(4-chlorophenyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 8-chloro-4-(4-chlorophenyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 104839596 |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 8-chloro-4-(4-chlorophenyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(c2ccc(Cl)cc2)c2cccc(Cl)c2N1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-9-4-6-10(7-5-9)18-8-13(19)17-14-11(16)2-1-3-12(14)18/h1-7H,8H2,(H,17,19) |
| InChIKey | UJMPOVVGJLLEIY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |