About [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea
[3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea (PubChem CID 67917148) has the molecular formula C17H11Cl3N4O4
and a molecular weight of 441.66 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea |
| PubChem CID | 67917148 |
| Molecular Formula | C17H11Cl3N4O4 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea |
| SMILES | NC(=O)NC1C(=O)N(C(=O)c2c(Cl)cccc2Cl)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11Cl3N4O4/c18-8-4-6-9(7-5-8)23-13(22-16(21)27)15(26)24(17(23)28)14(25)12-10(19)2-1-3-11(12)20/h1-7,13H,(H3,21,22,27) |
| InChIKey | YOTDDFIKYKJBBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea?
The IUPAC name of [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea (CID 67917148) is [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea.
What is the SMILES notation for [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea?
The canonical SMILES for [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea is NC(=O)NC1C(=O)N(C(=O)c2c(Cl)cccc2Cl)C(=O)N1c1ccc(Cl)cc1.
What is the InChIKey of [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea?
The InChIKey is YOTDDFIKYKJBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl3N4O4/c18-8-4-6-9(7-5-8)23-13(22-16(21)27)15(26)24(17(23)28)14(25)12-10(19)2-1-3-11(12)20/h1-7,13H,(H3,21,22,27).
What are the key properties of [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea?
[3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea has a molecular weight of 441.66 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea is sourced from PubChem (CID 67917148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).