C17H11Cl3N4O4 — CID 67917148
[3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea (PubChem CID 67917148) has the molecular formula C17H11Cl3N4O4 and a molecular weight of 441.66 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea.
| Compound Name | [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea |
|---|---|
| PubChem CID | 67917148 |
| Molecular Formula | C17H11Cl3N4O4 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | [3-(4-chlorophenyl)-1-(2,6-dichlorobenzoyl)-2,5-dioxoimidazolidin-4-yl]urea |
| SMILES | NC(=O)NC1C(=O)N(C(=O)c2c(Cl)cccc2Cl)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11Cl3N4O4/c18-8-4-6-9(7-5-8)23-13(22-16(21)27)15(26)24(17(23)28)14(25)12-10(19)2-1-3-11(12)20/h1-7,13H,(H3,21,22,27) |
| InChIKey | YOTDDFIKYKJBBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|