C12H12N2O6 — CID 175255540
carbamoyl benzoate;1-hydroxypyrrolidine-2,5-dione (PubChem CID 175255540) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is carbamoyl benzoate;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | carbamoyl benzoate;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175255540 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | carbamoyl benzoate;1-hydroxypyrrolidine-2,5-dione |
| SMILES | NC(=O)OC(=O)c1ccccc1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H7NO3.C4H5NO3/c9-8(11)12-7(10)6-4-2-1-3-5-6;6-3-1-2-4(7)5(3)8/h1-5H,(H2,9,11);8H,1-2H2 |
| InChIKey | MEOXXRFKZGIITA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|