C30H24N2O5 — CID 22351184
ethyl 2-[3-(naphthalene-2-carbonyl)-2,4-dioxo-5,5-diphenylimidazolidin-1-yl]acetate (PubChem CID 22351184) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is ethyl 2-[3-(naphthalene-2-carbonyl)-2,4-dioxo-5,5-diphenylimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(naphthalene-2-carbonyl)-2,4-dioxo-5,5-diphenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 22351184 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl 2-[3-(naphthalene-2-carbonyl)-2,4-dioxo-5,5-diphenylimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)N(C(=O)c2ccc3ccccc3c2)C(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O5/c1-2-37-26(33)20-31-29(36)32(27(34)23-18-17-21-11-9-10-12-22(21)19-23)28(35)30(31,24-13-5-3-6-14-24)25-15-7-4-8-16-25/h3-19H,2,20H2,1H3 |
| InChIKey | QYMFXWKULZWKKJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|