C29H27F3N4O6S — CID 87951287
ethyl 1-[[3-[(Z)-hydrazinylidenemethyl]phenyl]methyl]-4-[4-(2-sulfamoylphenyl)phenyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 87951287) has the molecular formula C29H27F3N4O6S and a molecular weight of 616.62 g/mol. Its IUPAC name is ethyl 1-[[3-[(Z)-hydrazinylidenemethyl]phenyl]methyl]-4-[4-(2-sulfamoylphenyl)phenyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 1-[[3-[(Z)-hydrazinylidenemethyl]phenyl]methyl]-4-[4-(2-sulfamoylphenyl)phenyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87951287 |
| Molecular Formula | C29H27F3N4O6S |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | ethyl 1-[[3-[(Z)-hydrazinylidenemethyl]phenyl]methyl]-4-[4-(2-sulfamoylphenyl)phenyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1cn(Cc2cccc(/C=N\N)c2)cc1-c1ccc(-c2ccccc2S(N)(=O)=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H26N4O4S.C2HF3O2/c1-2-35-27(32)25-18-31(16-20-7-5-6-19(14-20)15-30-28)17-24(25)22-12-10-21(11-13-22)23-8-3-4-9-26(23)36(29,33)34;3-2(4,5)1(6)7/h3-15,17-18H,2,16,28H2,1H3,(H2,29,33,34);(H,6,7)/b30-15-; |
| InChIKey | BAESJVHIZKXWHF-QGCFYLBGSA-N |
| XLogP | 4.62 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|