C15H19F3N4O4 — CID 87951505
2-[acetyl(methyl)amino]-3-[3-[(Z)-hydrazinylidenemethyl]phenyl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 87951505) has the molecular formula C15H19F3N4O4 and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-3-[3-[(Z)-hydrazinylidenemethyl]phenyl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[acetyl(methyl)amino]-3-[3-[(Z)-hydrazinylidenemethyl]phenyl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87951505 |
| Molecular Formula | C15H19F3N4O4 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[acetyl(methyl)amino]-3-[3-[(Z)-hydrazinylidenemethyl]phenyl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N(C)C(Cc1cccc(/C=N\N)c1)C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18N4O2.C2HF3O2/c1-9(18)17(2)12(13(14)19)7-10-4-3-5-11(6-10)8-16-15;3-2(4,5)1(6)7/h3-6,8,12H,7,15H2,1-2H3,(H2,14,19);(H,6,7)/b16-8-; |
| InChIKey | NEQNEDCFUSFQFI-SQIOZQJDSA-N |
| XLogP | 0.49 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|