C19H20N2O6 — CID 10215751
(2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-methylamino]propanamide (PubChem CID 10215751) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-methylamino]propanamide.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 10215751 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-methylamino]propanamide |
| SMILES | CN(C(=O)/C=C/c1ccc(O)c(O)c1)[C@@H](Cc1ccc(O)c(O)c1)C(N)=O |
| InChI | InChI=1S/C19H20N2O6/c1-21(18(26)7-4-11-2-5-14(22)16(24)9-11)13(19(20)27)8-12-3-6-15(23)17(25)10-12/h2-7,9-10,13,22-25H,8H2,1H3,(H2,20,27)/b7-4+/t13-/m0/s1 |
| InChIKey | QKGFASOTCUCGOI-LVDDQXARSA-N |
| XLogP | 1.08 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|