C13H15NO6 — CID 154430597
(2S)-2-(diacetylamino)-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 154430597) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is (2S)-2-(diacetylamino)-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(diacetylamino)-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 154430597 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (2S)-2-(diacetylamino)-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CC(=O)N(C(C)=O)[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C13H15NO6/c1-7(15)14(8(2)16)10(13(19)20)5-9-3-4-11(17)12(18)6-9/h3-4,6,10,17-18H,5H2,1-2H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | BOXFXFJSCCPGPJ-JTQLQIEISA-N |
| XLogP | 0.49 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|