C23H27NO7 — CID 72644295
tert-butyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyl-methylamino]propanoate (PubChem CID 72644295) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyl-methylamino]propanoate.
| Compound Name | tert-butyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 72644295 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | tert-butyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyl-methylamino]propanoate |
| SMILES | CN(C(=O)C=Cc1ccc(O)c(O)c1)C(Cc1ccc(O)c(O)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27NO7/c1-23(2,3)31-22(30)16(11-15-6-9-18(26)20(28)13-15)24(4)21(29)10-7-14-5-8-17(25)19(27)12-14/h5-10,12-13,16,25-28H,11H2,1-4H3 |
| InChIKey | QUALJFRHYHBMAE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|