C23H27F6N5O5 — CID 160907992
2-[N-[4-(4-aminophenyl)butyl]-3-methanehydrazonoylanilino]acetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 160907992) has the molecular formula C23H27F6N5O5 and a molecular weight of 567.49 g/mol. Its IUPAC name is 2-[N-[4-(4-aminophenyl)butyl]-3-methanehydrazonoylanilino]acetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[N-[4-(4-aminophenyl)butyl]-3-methanehydrazonoylanilino]acetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 160907992 |
| Molecular Formula | C23H27F6N5O5 |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[N-[4-(4-aminophenyl)butyl]-3-methanehydrazonoylanilino]acetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NN=Cc1cccc(N(CCCCc2ccc(N)cc2)CC(N)=O)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N5O.2C2HF3O2/c20-17-9-7-15(8-10-17)4-1-2-11-24(14-19(21)25)18-6-3-5-16(12-18)13-23-22;2*3-2(4,5)1(6)7/h3,5-10,12-13H,1-2,4,11,14,20,22H2,(H2,21,25);2*(H,6,7) |
| InChIKey | SQJXRBMFDOMXJD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|