C21H24F3N3O5 — CID 160977012
2-[N-[3-(4-aminophenyl)propyl]-3-carbamoylanilino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 160977012) has the molecular formula C21H24F3N3O5 and a molecular weight of 455.43 g/mol. Its IUPAC name is 2-[N-[3-(4-aminophenyl)propyl]-3-carbamoylanilino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[N-[3-(4-aminophenyl)propyl]-3-carbamoylanilino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160977012 |
| Molecular Formula | C21H24F3N3O5 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[N-[3-(4-aminophenyl)propyl]-3-carbamoylanilino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C(=O)O)N(CCCc1ccc(N)cc1)c1cccc(C(N)=O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3O3.C2HF3O2/c1-13(19(24)25)22(17-6-2-5-15(12-17)18(21)23)11-3-4-14-7-9-16(20)10-8-14;3-2(4,5)1(6)7/h2,5-10,12-13H,3-4,11,20H2,1H3,(H2,21,23)(H,24,25);(H,6,7) |
| InChIKey | SYZRSILUVNZJIG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|