C14H19N2NaO3S — CID 21362064
sodium 2-[3-carbamoyl-N-(2-ethylsulfanylethyl)anilino]propanoate (PubChem CID 21362064) has the molecular formula C14H19N2NaO3S and a molecular weight of 318.37 g/mol. Its IUPAC name is sodium 2-[3-carbamoyl-N-(2-ethylsulfanylethyl)anilino]propanoate.
| Compound Name | sodium 2-[3-carbamoyl-N-(2-ethylsulfanylethyl)anilino]propanoate |
|---|---|
| PubChem CID | 21362064 |
| Molecular Formula | C14H19N2NaO3S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | sodium 2-[3-carbamoyl-N-(2-ethylsulfanylethyl)anilino]propanoate |
| SMILES | CCSCCN(c1cccc(C(N)=O)c1)C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H20N2O3S.Na/c1-3-20-8-7-16(10(2)14(18)19)12-6-4-5-11(9-12)13(15)17;/h4-6,9-10H,3,7-8H2,1-2H3,(H2,15,17)(H,18,19);/q;+1/p-1 |
| InChIKey | MYPULFSONXJLNZ-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|