C20H29N3O — CID 21217870
3-[3-(aminomethyl)-N-[4-(4-aminophenyl)butyl]anilino]propan-1-ol (PubChem CID 21217870) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-N-[4-(4-aminophenyl)butyl]anilino]propan-1-ol.
| Compound Name | 3-[3-(aminomethyl)-N-[4-(4-aminophenyl)butyl]anilino]propan-1-ol |
|---|---|
| PubChem CID | 21217870 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 3-[3-(aminomethyl)-N-[4-(4-aminophenyl)butyl]anilino]propan-1-ol |
| SMILES | NCc1cccc(N(CCCO)CCCCc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C20H29N3O/c21-16-18-6-3-7-20(15-18)23(13-4-14-24)12-2-1-5-17-8-10-19(22)11-9-17/h3,6-11,15,24H,1-2,4-5,12-14,16,21-22H2 |
| InChIKey | BWBOBPMXGJQPCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|