C11H18N2O — CID 63229758
3-(3-amino-N-ethylanilino)propan-1-ol (PubChem CID 63229758) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-(3-amino-N-ethylanilino)propan-1-ol.
| Compound Name | 3-(3-amino-N-ethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 63229758 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-(3-amino-N-ethylanilino)propan-1-ol |
| SMILES | CCN(CCCO)c1cccc(N)c1 |
| InChI | InChI=1S/C11H18N2O/c1-2-13(7-4-8-14)11-6-3-5-10(12)9-11/h3,5-6,9,14H,2,4,7-8,12H2,1H3 |
| InChIKey | JRDSAHLTAXBREI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|