C14H24N2O2S — CID 106725980
3-N-(2-tert-butylsulfonylethyl)-3-N-ethylbenzene-1,3-diamine (PubChem CID 106725980) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 3-N-(2-tert-butylsulfonylethyl)-3-N-ethylbenzene-1,3-diamine.
| Compound Name | 3-N-(2-tert-butylsulfonylethyl)-3-N-ethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 106725980 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-N-(2-tert-butylsulfonylethyl)-3-N-ethylbenzene-1,3-diamine |
| SMILES | CCN(CCS(=O)(=O)C(C)(C)C)c1cccc(N)c1 |
| InChI | InChI=1S/C14H24N2O2S/c1-5-16(13-8-6-7-12(15)11-13)9-10-19(17,18)14(2,3)4/h6-8,11H,5,9-10,15H2,1-4H3 |
| InChIKey | HSUKGPMEWKETKC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|