C13H16N4O5 — CID 88642235
methyl 4-amino-2-[[4-(hydroxyiminomethyl)phenyl]carbamoylamino]-4-oxobutanoate (PubChem CID 88642235) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is methyl 4-amino-2-[[4-(hydroxyiminomethyl)phenyl]carbamoylamino]-4-oxobutanoate.
| Compound Name | methyl 4-amino-2-[[4-(hydroxyiminomethyl)phenyl]carbamoylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 88642235 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | methyl 4-amino-2-[[4-(hydroxyiminomethyl)phenyl]carbamoylamino]-4-oxobutanoate |
| SMILES | COC(=O)C(CC(N)=O)NC(=O)Nc1ccc(C=NO)cc1 |
| InChI | InChI=1S/C13H16N4O5/c1-22-12(19)10(6-11(14)18)17-13(20)16-9-4-2-8(3-5-9)7-15-21/h2-5,7,10,21H,6H2,1H3,(H2,14,18)(H2,16,17,20) |
| InChIKey | ADOPWFXESRYZGN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|