C23H33N7O6 — CID 22862781
(3S)-4-benzamido-3-[[2-[(3S)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazocan-1-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 22862781) has the molecular formula C23H33N7O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is (3S)-4-benzamido-3-[[2-[(3S)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazocan-1-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-benzamido-3-[[2-[(3S)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazocan-1-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22862781 |
| Molecular Formula | C23H33N7O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (3S)-4-benzamido-3-[[2-[(3S)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazocan-1-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCC[C@@H]1NCCCCN(CC(=O)N[C@@H](CC(=O)O)C(=O)NC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H33N7O6/c24-23(25)27-11-6-9-16-22(36)30(12-5-4-10-26-16)14-18(31)28-17(13-19(32)33)21(35)29-20(34)15-7-2-1-3-8-15/h1-3,7-8,16-17,26H,4-6,9-14H2,(H,28,31)(H,32,33)(H4,24,25,27)(H,29,34,35)/t16-,17-/m0/s1 |
| InChIKey | BWJSNWRILQFNPO-IRXDYDNUSA-N |
| XLogP | -1.46 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|