C19H26N6O6 — CID 70063041
(3S)-4-benzamido-3-[[2-[5-(diaminomethylideneamino)pentanoylamino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 70063041) has the molecular formula C19H26N6O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (3S)-4-benzamido-3-[[2-[5-(diaminomethylideneamino)pentanoylamino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-benzamido-3-[[2-[5-(diaminomethylideneamino)pentanoylamino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70063041 |
| Molecular Formula | C19H26N6O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (3S)-4-benzamido-3-[[2-[5-(diaminomethylideneamino)pentanoylamino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCCC(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N6O6/c20-19(21)22-9-5-4-8-14(26)23-11-15(27)24-13(10-16(28)29)18(31)25-17(30)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,23,26)(H,24,27)(H,28,29)(H4,20,21,22)(H,25,30,31)/t13-/m0/s1 |
| InChIKey | PFGBHAJFJYGWHV-ZDUSSCGKSA-N |
| XLogP | -1.54 |
| TPSA | 206.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|