C17H25N5O4 — CID 19996407
3-[[3-[6-(diaminomethylideneamino)hexanoylamino]benzoyl]amino]propanoic acid (PubChem CID 19996407) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[[3-[6-(diaminomethylideneamino)hexanoylamino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[6-(diaminomethylideneamino)hexanoylamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19996407 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-[[3-[6-(diaminomethylideneamino)hexanoylamino]benzoyl]amino]propanoic acid |
| SMILES | NC(N)=NCCCCCC(=O)Nc1cccc(C(=O)NCCC(=O)O)c1 |
| InChI | InChI=1S/C17H25N5O4/c18-17(19)21-9-3-1-2-7-14(23)22-13-6-4-5-12(11-13)16(26)20-10-8-15(24)25/h4-6,11H,1-3,7-10H2,(H,20,26)(H,22,23)(H,24,25)(H4,18,19,21) |
| InChIKey | UCTYWIIRTCPNNY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|