C18H33N5O6 — CID 18653925
(2S)-2-[[(2S)-3-carboxy-2-[8-(diaminomethylideneamino)octanoylamino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 18653925) has the molecular formula C18H33N5O6 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-[8-(diaminomethylideneamino)octanoylamino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-[8-(diaminomethylideneamino)octanoylamino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18653925 |
| Molecular Formula | C18H33N5O6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-[8-(diaminomethylideneamino)octanoylamino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CCCCCCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H33N5O6/c1-11(2)15(17(28)29)23-16(27)12(10-14(25)26)22-13(24)8-6-4-3-5-7-9-21-18(19)20/h11-12,15H,3-10H2,1-2H3,(H,22,24)(H,23,27)(H,25,26)(H,28,29)(H4,19,20,21)/t12-,15-/m0/s1 |
| InChIKey | DMGZGSDLHWETHN-WFASDCNBSA-N |
| XLogP | -0.21 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|