C17H33N7O6 — CID 18640752
(2S)-2-[[(2S)-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid (PubChem CID 18640752) has the molecular formula C17H33N7O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18640752 |
| Molecular Formula | C17H33N7O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CNCC(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H33N7O6/c1-9(2)14(16(29)30)24-15(28)11(6-13(26)27)23-12(25)8-21-7-10(18)4-3-5-22-17(19)20/h9-11,14,21H,3-8,18H2,1-2H3,(H,23,25)(H,24,28)(H,26,27)(H,29,30)(H4,19,20,22)/t10?,11-,14-/m0/s1 |
| InChIKey | PJFYMMXGQPDSAL-UCOFZHQHSA-N |
| XLogP | -2.86 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|