C19H34N6O7 — CID 15234527
(2S)-2-[[(2S)-3-carboxy-2-[[2-[7-(diaminomethylideneamino)heptanoylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 15234527) has the molecular formula C19H34N6O7 and a molecular weight of 458.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-[[2-[7-(diaminomethylideneamino)heptanoylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-[[2-[7-(diaminomethylideneamino)heptanoylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 15234527 |
| Molecular Formula | C19H34N6O7 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-[[2-[7-(diaminomethylideneamino)heptanoylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)CCCCCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H34N6O7/c1-11(2)16(18(31)32)25-17(30)12(9-15(28)29)24-14(27)10-23-13(26)7-5-3-4-6-8-22-19(20)21/h11-12,16H,3-10H2,1-2H3,(H,23,26)(H,24,27)(H,25,30)(H,28,29)(H,31,32)(H4,20,21,22)/t12-,16-/m0/s1 |
| InChIKey | YYAOPPYCNNUTDS-LRDDRELGSA-N |
| XLogP | -1.49 |
| TPSA | 226.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|