C20H32N6O5S — CID 73195488
2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]-N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]acetamide (PubChem CID 73195488) has the molecular formula C20H32N6O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]-N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]acetamide.
| Compound Name | 2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]-N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]acetamide |
|---|---|
| PubChem CID | 73195488 |
| Molecular Formula | C20H32N6O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]-N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]acetamide |
| SMILES | NC(N)=NCCCC(CO)NC(=O)CN1CCCC(NS(=O)(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H32N6O5S/c21-20(22)23-10-4-8-16(13-27)24-18(28)12-26-11-5-9-17(19(26)29)25-32(30,31)14-15-6-2-1-3-7-15/h1-3,6-7,16-17,25,27H,4-5,8-14H2,(H,24,28)(H4,21,22,23) |
| InChIKey | XDKIPFSFKKBMSP-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|