C21H33N7O7S — CID 10768481
(2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[(3S)-3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]propanamide (PubChem CID 10768481) has the molecular formula C21H33N7O7S and a molecular weight of 527.60 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[(3S)-3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]propanamide.
| Compound Name | (2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[(3S)-3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 10768481 |
| Molecular Formula | C21H33N7O7S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[(3S)-3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)N[C@H](CO)CCC/N=C(\N)N[N+](=O)[O-])N1CCC[C@H](NS(=O)(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H33N7O7S/c1-15(19(30)24-17(13-29)9-5-11-23-21(22)25-28(32)33)27-12-6-10-18(20(27)31)26-36(34,35)14-16-7-3-2-4-8-16/h2-4,7-8,15,17-18,26,29H,5-6,9-14H2,1H3,(H,24,30)(H3,22,23,25)/t15-,17-,18-/m0/s1 |
| InChIKey | MUWKRXBWWLYMAV-SZMVWBNQSA-N |
| XLogP | -1.16 |
| TPSA | 209.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|