C20H31N7O7S — CID 54336620
N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide (PubChem CID 54336620) has the molecular formula C20H31N7O7S and a molecular weight of 513.58 g/mol. Its IUPAC name is N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide.
| Compound Name | N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 54336620 |
| Molecular Formula | C20H31N7O7S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]-2-[3-(benzylsulfonylamino)-2-oxopiperidin-1-yl]acetamide |
| SMILES | N/C(=N\CCCC(CO)NC(=O)CN1CCCC(NS(=O)(=O)Cc2ccccc2)C1=O)N[N+](=O)[O-] |
| InChI | InChI=1S/C20H31N7O7S/c21-20(24-27(31)32)22-10-4-8-16(13-28)23-18(29)12-26-11-5-9-17(19(26)30)25-35(33,34)14-15-6-2-1-3-7-15/h1-3,6-7,16-17,25,28H,4-5,8-14H2,(H,23,29)(H3,21,22,24) |
| InChIKey | TVXURAPXJVZPBG-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 209.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|