C22H34N4O4S — CID 22985418
N-[(4-aminocyclohexyl)methyl]-2-[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]acetamide (PubChem CID 22985418) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-2-[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]acetamide.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-2-[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 22985418 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-2-[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]acetamide |
| SMILES | NC1CCC(CNC(=O)CN2CCCCC(NS(=O)(=O)Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C22H34N4O4S/c23-19-11-9-17(10-12-19)14-24-21(27)15-26-13-5-4-8-20(22(26)28)25-31(29,30)16-18-6-2-1-3-7-18/h1-3,6-7,17,19-20,25H,4-5,8-16,23H2,(H,24,27) |
| InChIKey | FQRSJLCZEVOLDK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |