C26H29N5O4S — CID 22985412
N-[(4-carbamimidoylphenyl)methyl]-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxoazepan-1-yl]acetamide (PubChem CID 22985412) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxoazepan-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxoazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 22985412 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[3-(naphthalen-2-ylsulfonylamino)-2-oxoazepan-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CN2CCCCC(NS(=O)(=O)c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C26H29N5O4S/c27-25(28)20-10-8-18(9-11-20)16-29-24(32)17-31-14-4-3-7-23(26(31)33)30-36(34,35)22-13-12-19-5-1-2-6-21(19)15-22/h1-2,5-6,8-13,15,23,30H,3-4,7,14,16-17H2,(H3,27,28)(H,29,32) |
| InChIKey | BMABHCREOJIEFU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|