C28H30N4O7S — CID 18989338
ethyl 2-[3-(benzo[f][1,3]benzodioxol-6-ylsulfonylamino)-2-oxopiperidin-1-yl]-3-(4-carbamimidoylphenyl)propanoate (PubChem CID 18989338) has the molecular formula C28H30N4O7S and a molecular weight of 566.64 g/mol. Its IUPAC name is ethyl 2-[3-(benzo[f][1,3]benzodioxol-6-ylsulfonylamino)-2-oxopiperidin-1-yl]-3-(4-carbamimidoylphenyl)propanoate.
| Compound Name | ethyl 2-[3-(benzo[f][1,3]benzodioxol-6-ylsulfonylamino)-2-oxopiperidin-1-yl]-3-(4-carbamimidoylphenyl)propanoate |
|---|---|
| PubChem CID | 18989338 |
| Molecular Formula | C28H30N4O7S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | ethyl 2-[3-(benzo[f][1,3]benzodioxol-6-ylsulfonylamino)-2-oxopiperidin-1-yl]-3-(4-carbamimidoylphenyl)propanoate |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)OCC)N2CCCC(NS(=O)(=O)c3ccc4cc5c(cc4c3)OCO5)C2=O)cc1 |
| InChI | InChI=1S/C28H30N4O7S/c1-2-37-28(34)23(12-17-5-7-18(8-6-17)26(29)30)32-11-3-4-22(27(32)33)31-40(35,36)21-10-9-19-14-24-25(39-16-38-24)15-20(19)13-21/h5-10,13-15,22-23,31H,2-4,11-12,16H2,1H3,(H3,29,30) |
| InChIKey | NNEZENXUJUEAOG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|