C27H29N4O7S- — CID 57003092
1-[2-(4-carbamimidoylphenyl)-1-carboxyethyl]-3-[(6,7-dimethoxynaphthalen-2-yl)-sulfinatoamino]-2-oxopiperidine (PubChem CID 57003092) has the molecular formula C27H29N4O7S- and a molecular weight of 553.62 g/mol. Its IUPAC name is 1-[2-(4-carbamimidoylphenyl)-1-carboxyethyl]-3-[(6,7-dimethoxynaphthalen-2-yl)-sulfinatoamino]-2-oxopiperidine.
| Compound Name | 1-[2-(4-carbamimidoylphenyl)-1-carboxyethyl]-3-[(6,7-dimethoxynaphthalen-2-yl)-sulfinatoamino]-2-oxopiperidine |
|---|---|
| PubChem CID | 57003092 |
| Molecular Formula | C27H29N4O7S- |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 1-[2-(4-carbamimidoylphenyl)-1-carboxyethyl]-3-[(6,7-dimethoxynaphthalen-2-yl)-sulfinatoamino]-2-oxopiperidine |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)O)N2CCCC(N(c3ccc4cc(OC)c(OC)cc4c3)S(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C27H30N4O7S/c1-37-23-14-18-9-10-20(13-19(18)15-24(23)38-2)31(39(35)36)21-4-3-11-30(26(21)32)22(27(33)34)12-16-5-7-17(8-6-16)25(28)29/h5-10,13-15,21-22H,3-4,11-12H2,1-2H3,(H3,28,29)(H,33,34)(H,35,36)/p-1 |
| InChIKey | CNLBOKJGZROXTG-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 169.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|