C24H27FN4O5 — CID 67554940
2-[4-[4-(4-carbamimidoylphenoxy)butyl]-2,3-dioxopiperazin-1-yl]-3-(4-fluorophenyl)propanoic acid (PubChem CID 67554940) has the molecular formula C24H27FN4O5 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenoxy)butyl]-2,3-dioxopiperazin-1-yl]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenoxy)butyl]-2,3-dioxopiperazin-1-yl]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 67554940 |
| Molecular Formula | C24H27FN4O5 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenoxy)butyl]-2,3-dioxopiperazin-1-yl]-3-(4-fluorophenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCN2CCN(C(Cc3ccc(F)cc3)C(=O)O)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C24H27FN4O5/c25-18-7-3-16(4-8-18)15-20(24(32)33)29-13-12-28(22(30)23(29)31)11-1-2-14-34-19-9-5-17(6-10-19)21(26)27/h3-10,20H,1-2,11-15H2,(H3,26,27)(H,32,33) |
| InChIKey | OISPEWRWMWJOIL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|