C20H23N5O5S — CID 22122315
3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-(1,3-thiazol-5-yl)propanoic acid (PubChem CID 22122315) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is 3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-(1,3-thiazol-5-yl)propanoic acid.
| Compound Name | 3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-(1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 22122315 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-(1,3-thiazol-5-yl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCCN2CCN(C(CC(=O)O)c3cncs3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C20H23N5O5S/c21-18(22)13-2-4-14(5-3-13)30-9-1-6-24-7-8-25(20(29)19(24)28)15(10-17(26)27)16-11-23-12-31-16/h2-5,11-12,15H,1,6-10H2,(H3,21,22)(H,26,27) |
| InChIKey | JIYGDBCKFJJDKI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|